5-Tributylstannyl-1H-pyrazole-3-carboxylic acid ethyl ester structure
|
Common Name | 5-Tributylstannyl-1H-pyrazole-3-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 141998-85-8 | Molecular Weight | 429.17600 | |
| Density | N/A | Boiling Point | 474.733ºC at 760 mmHg | |
| Molecular Formula | C18H34N2O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.91ºC | |
| Name | ethyl 5-tributylstannyl-1H-pyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 474.733ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H34N2O2Sn |
| Molecular Weight | 429.17600 |
| Flash Point | 240.91ºC |
| Exact Mass | 430.16400 |
| PSA | 54.98000 |
| LogP | 4.64250 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | IVTNFPBKDVQZLF-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(C(=O)OCC)n[nH]1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl pyrazol-5-yl stannane 2-carboxylate |
| ethyl 3-(tributylstannyl)-1H-pyrazole-5-carboxylate |
| 3-(tri-n-butylstannyl)-5-carbethoxypyrazole |
| 5-Tributylstannyl-1H-pyrazole-3-carboxylic acid ethyl ester |
| 5-tributylstannanyl-2H-pyrazole-3-carboxylic acid ethyl ester |
| ethyl 3(5)-tributylstannylpyrazole-5(3)-carboxylate |
| ethyl 5-(tributylstannyl)-1H-pyrazole-3-carboxylate |