4,7-dimethoxy-2,3-dimethyl-1H-indole structure
|
Common Name | 4,7-dimethoxy-2,3-dimethyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 14201-41-3 | Molecular Weight | 205.25300 | |
| Density | 1.125g/cm3 | Boiling Point | 370.8ºC at 760 mmHg | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.1ºC | |
| Name | 4,7-dimethoxy-2,3-dimethyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 370.8ºC at 760 mmHg |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25300 |
| Flash Point | 135.1ºC |
| Exact Mass | 205.11000 |
| PSA | 34.25000 |
| LogP | 2.80190 |
| Vapour Pressure | 2.31E-05mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | TXUCJSRUALPKHM-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c2c(C)c(C)[nH]c12 |
|
~%
4,7-dimethoxy-2... CAS#:14201-41-3 |
| Literature: Blackhall; Thomson Journal of the Chemical Society, 1954 , p. 3916,3918 |
| 4,7-Dimethoxy-2,3-dimethyl-indol |
| HMS2885J23 |
| 4,7-dimethoxy-2,3-dimethyl-indole |
| 2,3-Dimethyl-4,7-dimethoxyindol |