N,N,N-Tripropyl-1-propanaminium salt with 2,2'-dithiobis[benzoic acid] (1:1) structure
|
Common Name | N,N,N-Tripropyl-1-propanaminium salt with 2,2'-dithiobis[benzoic acid] (1:1) | ||
|---|---|---|---|---|
| CAS Number | 142051-76-1 | Molecular Weight | 491.70600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H37NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2'-dithiodibenzoic acid mono-(tetrapropylammonium) salt |
|---|
| Molecular Formula | C26H37NO4S2 |
|---|---|
| Molecular Weight | 491.70600 |
| Exact Mass | 491.21600 |
| PSA | 128.03000 |
| LogP | 5.99090 |
| InChIKey | VOJJJXGWYPSTLF-UHFFFAOYSA-M |
| SMILES | CCC[N+](CCC)(CCC)CCC.O=C([O-])c1ccccc1SSc1ccccc1C(=O)O |