6-chloro-4-oxyimino-1-phenyl-1,2,3,4-tetrahydroquinoline structure
|
Common Name | 6-chloro-4-oxyimino-1-phenyl-1,2,3,4-tetrahydroquinoline | ||
|---|---|---|---|---|
| CAS Number | 14206-74-7 | Molecular Weight | 272.73000 | |
| Density | 1.29g/cm3 | Boiling Point | 471.8ºC at 760mmHg | |
| Molecular Formula | C15H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.1ºC | |
| Name | (NZ)-N-(6-chloro-1-phenyl-2,3-dihydroquinolin-4-ylidene)hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 471.8ºC at 760mmHg |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.73000 |
| Flash Point | 239.1ºC |
| Exact Mass | 272.07200 |
| PSA | 35.83000 |
| LogP | 4.12510 |
| Vapour Pressure | 1.05E-09mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | RVDASWLODZFDBZ-VKAVYKQESA-N |
| SMILES | ON=C1CCN(c2ccccc2)c2ccc(Cl)cc21 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| M-7074 |
| 6-chloro-1-phenyl-2,3-dihydro-1H-quinolin-4-one oxime |
| 4-Quinolinone,1,2,3,4-tetrahydro-6-chloro-1-phenyl-,oxime |