4-bromo-2,5-dimethylbenzenesulfonyl chloride(SALTDATA: FREE) structure
|
Common Name | 4-bromo-2,5-dimethylbenzenesulfonyl chloride(SALTDATA: FREE) | ||
|---|---|---|---|---|
| CAS Number | 14207-30-8 | Molecular Weight | 283.57000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8BrClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-2,5-dimethylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8BrClO2S |
|---|---|
| Molecular Weight | 283.57000 |
| Exact Mass | 281.91200 |
| PSA | 42.52000 |
| LogP | 4.07420 |
| InChIKey | NTZAPNSSTHUFND-UHFFFAOYSA-N |
| SMILES | Cc1cc(S(=O)(=O)Cl)c(C)cc1Br |
| HS Code | 2904909090 |
|---|
|
~%
4-bromo-2,5-dim... CAS#:14207-30-8 |
| Literature: Berg, Stefan; Bergh, Margareta; Hellberg, Sven; Hoegdin, Katharina; Lo-Alfredsson, Yvonne; Soederman, Peter; Von Berg, Stefan; Weigelt, Tatjana; Ormoe, Mats; Xue, Yafeng; Tucker, Julie; Neelissen, Jan; Jerning, Eva; Nilsson, Yvonne; Bhat, Ratan Journal of Medicinal Chemistry, 2012 , vol. 55, # 21 p. 9107 - 9119,13 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-bromo-2,5-dimethyl-benzenesulfonyl chloride |
| (4-bromo-2,5-dimethylphenyl)chlorosulfone |
| 4-Brom-2,5-dimethyl-benzolsulfonylchlorid |
| 4-Brom-2,5-dimethyl-benzolsulfochlorid |
| 4-bromo-2,5-dimethylbenzene-1-sulfonyl chloride |