benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate structure
|
Common Name | benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1420797-72-3 | Molecular Weight | 377.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H23N3O3 |
|---|---|
| Molecular Weight | 377.4 |
| InChIKey | SSGWCKHLZCRNQD-UHFFFAOYSA-N |
| SMILES | CC(=O)c1nc2ccccc2n1C1CCN(C(=O)OCc2ccccc2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1420797-72-3? |
| A: Chinese name of 1420797-72-3 is 1420797-72-3. |
| Q: What is the CAS number of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate? |
| A: CAS number of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate is 1420797-72-3. |
| Q: What is the English name of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate? |
| A: The English name of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate is benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate. |
| Q: What is the InChIKey of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate? |
| A: InChIKey of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate is SSGWCKHLZCRNQD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate? |
| A: Molecular weight of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate is 377.4. |
| Q: What is the molecular formula of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate? |
| A: Molecular formula of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate is C22H23N3O3. |
| Q: What is the SMILES notation of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate? |
| A: SMILES notation of benzyl 4-(2-acetyl-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate is CC(=O)c1nc2ccccc2n1C1CCN(C(=O)OCc2ccccc2)CC1. |