1-(1-Benzylazetidin-3-yl)propane-1,3-diol
Modify Date: 2026-07-13 21:56:56
1-(1-Benzylazetidin-3-yl)propane-1,3-diol structure
|
Common Name | 1-(1-Benzylazetidin-3-yl)propane-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 1420982-83-7 | Molecular Weight | 221.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(1-Benzylazetidin-3-yl)propane-1,3-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO2 |
|---|---|
| Molecular Weight | 221.29 |
| InChIKey | WHSXORPGNZHVNF-UHFFFAOYSA-N |
| SMILES | OCCC(O)C1CN(Cc2ccccc2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol? |
| A: The English name of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol is 1-(1-Benzylazetidin-3-yl)propane-1,3-diol. |
| Q: What is the SMILES notation of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol? |
| A: SMILES notation of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol is OCCC(O)C1CN(Cc2ccccc2)C1. |
| Q: What is the Chinese name of 1420982-83-7? |
| A: Chinese name of 1420982-83-7 is 1420982-83-7. |
| Q: What is the molecular formula of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol? |
| A: Molecular formula of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol is C13H19NO2. |
| Q: What is the InChIKey of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol? |
| A: InChIKey of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol is WHSXORPGNZHVNF-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol? |
| A: CAS number of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol is 1420982-83-7. |
| Q: What is the molecular weight of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol? |
| A: Molecular weight of 1-(1-Benzylazetidin-3-yl)propane-1,3-diol is 221.29. |