5-Ethyl-5-(3-hydroxy-3-methylbutyl)barbituric acid structure
|
Common Name | 5-Ethyl-5-(3-hydroxy-3-methylbutyl)barbituric acid | ||
|---|---|---|---|---|
| CAS Number | 1421-07-4 | Molecular Weight | 242.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethyl-5-(3-hydroxy-3-methylbutyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H18N2O4 |
|---|---|
| Molecular Weight | 242.27200 |
| Exact Mass | 242.12700 |
| PSA | 102.48000 |
| LogP | 0.85170 |
| InChIKey | PUVZPWLDMBLALZ-UHFFFAOYSA-N |
| SMILES | CCC1(CCC(C)(C)O)C(=O)NC(=O)NC1=O |
|
~30%
5-Ethyl-5-(3-hy... CAS#:1421-07-4 |
| Literature: Kato; Kohketsu Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 1 p. 268 - 272 |
|
~%
5-Ethyl-5-(3-hy... CAS#:1421-07-4 |
| Literature: Maynert Journal of Biological Chemistry, 1952 , vol. 195, p. 397,401 |
| Faktor I |
| 3'-Hydroxyamobarbital |