potassium (2,4-dichlorophenoxy)acetate
potassium (2,4-dichlorophenoxy)acetate structure
|
Common Name | potassium (2,4-dichlorophenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 14214-89-2 | Molecular Weight | 259.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5Cl2KO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dichlorophenoxyacetic acid potassium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5Cl2KO3 |
|---|---|
| Molecular Weight | 259.12800 |
| Exact Mass | 257.92500 |
| PSA | 49.36000 |
| LogP | 1.12210 |
| InChIKey | XKTWNXNNDKRPHR-UHFFFAOYSA-M |
| SMILES | O=C([O-])COc1ccc(Cl)cc1Cl.[K+] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Potassium 2,4-dichloro-phenoxy acetate |
| potassium (2,4-dichlorophenoxy)acetate |
| potassium 2,4-dichlorophenoxyacetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,4-dichlorophenoxyacetic acid potassium? |
| A: InChIKey of 2,4-dichlorophenoxyacetic acid potassium is XKTWNXNNDKRPHR-UHFFFAOYSA-M. |
| Q: What is the molecular formula of 2,4-dichlorophenoxyacetic acid potassium? |
| A: Molecular formula of 2,4-dichlorophenoxyacetic acid potassium is C8H5Cl2KO3. |
| Q: What is the molecular weight of 2,4-dichlorophenoxyacetic acid potassium? |
| A: Molecular weight of 2,4-dichlorophenoxyacetic acid potassium is 259.12800. |
| Q: What is the CAS number of 2,4-dichlorophenoxyacetic acid potassium? |
| A: CAS number of 2,4-dichlorophenoxyacetic acid potassium is 14214-89-2. |
| Q: What is the polar surface area (PSA) of 2,4-dichlorophenoxyacetic acid potassium? |
| A: Polar surface area (PSA) of 2,4-dichlorophenoxyacetic acid potassium is 49.36000. |
| Q: What is the SMILES notation of 2,4-dichlorophenoxyacetic acid potassium? |
| A: SMILES notation of 2,4-dichlorophenoxyacetic acid potassium is O=C([O-])COc1ccc(Cl)cc1Cl.[K+]. |
| Q: What is the Chinese name of 14214-89-2? |
| A: Chinese name of 14214-89-2 is 14214-89-2. |
| Q: What is the LogP of 2,4-dichlorophenoxyacetic acid potassium? |
| A: LogP of 2,4-dichlorophenoxyacetic acid potassium is 1.12210. |
| Q: What is the English name of 2,4-dichlorophenoxyacetic acid potassium? |
| A: The English name of 2,4-dichlorophenoxyacetic acid potassium is 2,4-dichlorophenoxyacetic acid potassium. |
| Q: What English synonyms does 2,4-dichlorophenoxyacetic acid potassium have? |
| A: English synonyms of 2,4-dichlorophenoxyacetic acid potassium: Potassium 2,4-dichloro-phenoxy acetate, potassium (2,4-dichlorophenoxy)acetate, potassium 2,4-dichlorophenoxyacetate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |