1-(4-(4-Methyl-1H-imidazol-1-yl)phenyl)ethanone structure
|
Common Name | 1-(4-(4-Methyl-1H-imidazol-1-yl)phenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 142161-53-3 | Molecular Weight | 200.23600 | |
| Density | 1.11 | Boiling Point | 375.3ºC at 760mmHg | |
| Molecular Formula | C12H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.7ºC | |
| Name | 1-[4-(4-methylimidazol-1-yl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11 |
|---|---|
| Boiling Point | 375.3ºC at 760mmHg |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.23600 |
| Flash Point | 180.7ºC |
| Exact Mass | 200.09500 |
| PSA | 34.89000 |
| LogP | 2.38330 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | XVSAOSPGDUFLCH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(-n2cnc(C)c2)cc1 |
| HS Code | 2933290090 |
|---|
|
~%
1-(4-(4-Methyl-... CAS#:142161-53-3 |
| Literature: US4935430 A1, ; |
|
~19%
1-(4-(4-Methyl-... CAS#:142161-53-3 |
| Literature: Cooper, Kelvin; Fray, M. Jonathan; Parry, M. John; Richardson, Kenneth; Steele, John Journal of Medicinal Chemistry, 1992 , vol. 35, # 17 p. 3115 - 3129 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethanone,1-[4-(4-methyl-1H-imidazol-1-yl)phenyl] |
| 1-(4-(4-methyl-1H-imidazol-1-yl)phenyl)ethanone |
| 4--(4-Methylimidazol-1-yl)acetophenone |