3-Heptene,5,5,6,6,7,7,7-heptafluoro-3-nitro-
Modify Date: 2025-08-26 16:08:35
3-Heptene,5,5,6,6,7,7,7-heptafluoro-3-nitro- structure
|
Common Name | 3-Heptene,5,5,6,6,7,7,7-heptafluoro-3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 1422-67-9 | Molecular Weight | 269.11700 | |
| Density | 1.427g/cm3 | Boiling Point | 181.6ºC at 760mmHg | |
| Molecular Formula | C7H6F7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 63.7ºC | |
| Name | (Z)-5,5,6,6,7,7,7-heptafluoro-3-nitrohept-3-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 181.6ºC at 760mmHg |
| Molecular Formula | C7H6F7NO2 |
| Molecular Weight | 269.11700 |
| Flash Point | 63.7ºC |
| Exact Mass | 269.02900 |
| PSA | 45.82000 |
| LogP | 3.91310 |
| Vapour Pressure | 1.15mmHg at 25°C |
| Index of Refraction | 1.358 |
| InChIKey | LAUSIHIXQCNLQG-ARJAWSKDSA-N |
| SMILES | CCC(=CC(F)(F)C(F)(F)C(F)(F)F)[N+](=O)[O-] |
|
~%
3-Heptene,5,5,6... CAS#:1422-67-9 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:356-66-1| 5,5,6,6,7,7,7-heptafluoro-3-nitro-hept-3c-ene |
| 5,5,6,6,7,7,7-Heptafluor-3-nitro-hept-3c-en |
| 5.5.6.6.7.7.7-Heptafluor-3-nitro-hept-3-en |