((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone
Modify Date: 2026-08-28 17:16:12
![((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone Structure](https://www.chemsrc.com/extcaspic/166/1422058-92-1.png)
((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone structure
|
Common Name | ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 1422058-92-1 | Molecular Weight | 223.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13N3OS |
|---|---|
| Molecular Weight | 223.30 |
| InChIKey | ISBHXEZKFUSMHI-APPZFPTMSA-N |
| SMILES | O=C(c1cscn1)N1CCC2NCCC21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1422058-92-1? |
| A: Chinese name of 1422058-92-1 is 1422058-92-1. |
| Q: What is the SMILES notation of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone? |
| A: SMILES notation of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone is O=C(c1cscn1)N1CCC2NCCC21. |
| Q: What is the CAS number of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone? |
| A: CAS number of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone is 1422058-92-1. |
| Q: What is the InChIKey of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone? |
| A: InChIKey of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone is ISBHXEZKFUSMHI-APPZFPTMSA-N. |
| Q: What is the molecular formula of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone? |
| A: Molecular formula of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone is C10H13N3OS. |
| Q: What is the English name of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone? |
| A: The English name of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone is ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone. |
| Q: What is the molecular weight of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone? |
| A: Molecular weight of ((3aR,6aS)-hexahydropyrrolo[3,2-b]pyrrol-1(2H)-yl)(thiazol-4-yl)methanone is 223.30. |