2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane
Modify Date: 2025-09-09 22:49:59
![2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane Structure](https://www.chemsrc.com/extcaspic/211/1422067-16-0.png)
2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane structure
|
Common Name | 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane | ||
|---|---|---|---|---|
| CAS Number | 1422067-16-0 | Molecular Weight | 236.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20N2S |
|---|---|
| Molecular Weight | 236.38 |
| InChIKey | SYZWXNYMZUAEQA-UHFFFAOYSA-N |
| SMILES | c1csc(CN2CCC3(CCNCC3)C2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane? |
| A: InChIKey of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane is SYZWXNYMZUAEQA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane? |
| A: Molecular weight of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane is 236.38. |
| Q: What is the SMILES notation of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane? |
| A: SMILES notation of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane is c1csc(CN2CCC3(CCNCC3)C2)c1. |
| Q: What is the Chinese name of 1422067-16-0? |
| A: Chinese name of 1422067-16-0 is 1422067-16-0. |
| Q: What is the English name of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane? |
| A: The English name of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane is 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane. |
| Q: What is the molecular formula of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane? |
| A: Molecular formula of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane is C13H20N2S. |
| Q: What is the CAS number of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane? |
| A: CAS number of 2-(Thiophen-2-ylmethyl)-2,8-diazaspiro[4.5]decane is 1422067-16-0. |