3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine
Modify Date: 2025-09-10 08:10:14
![3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine Structure](https://www.chemsrc.com/extcaspic/194/1422141-67-0.png)
3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine structure
|
Common Name | 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine | ||
|---|---|---|---|---|
| CAS Number | 1422141-67-0 | Molecular Weight | 231.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14FN3 |
|---|---|
| Molecular Weight | 231.27 |
| InChIKey | YOZGUJJGVBYZQY-UHFFFAOYSA-N |
| SMILES | Fc1ccc(-c2n[nH]c3c2CCNCC3)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 25, Current Page 1 of 3
1
2
3
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1422141-67-0? |
| A: Chinese name of 1422141-67-0 is 1422141-67-0. |
| Q: What is the molecular weight of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine? |
| A: Molecular weight of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine is 231.27. |
| Q: What is the CAS number of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine? |
| A: CAS number of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine is 1422141-67-0. |
| Q: What is the molecular formula of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine? |
| A: Molecular formula of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine is C13H14FN3. |
| Q: What is the English name of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine? |
| A: The English name of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine is 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine. |
| Q: What is the InChIKey of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine? |
| A: InChIKey of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine is YOZGUJJGVBYZQY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine? |
| A: SMILES notation of 3-(4-Fluorophenyl)-1,4,5,6,7,8-Hexahydropyrazolo[3,4-D]Azepine is Fc1ccc(-c2n[nH]c3c2CCNCC3)cc1. |