5'-Hydroxyphenyl Carvedilol structure
|
Common Name | 5'-Hydroxyphenyl Carvedilol | ||
|---|---|---|---|---|
| CAS Number | 142227-51-8 | Molecular Weight | 422.47400 | |
| Density | 1.305g/cm3 | Boiling Point | 702ºC at 760 mmHg | |
| Molecular Formula | C24H26N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 378.3ºC | |
Use of 5'-Hydroxyphenyl Carvedilol5'-Hydroxyphenyl Carvedilol is a metabolite of Carvedilol. 5'-Hydroxyphenyl Carvedilol is used in the treatment of hypertension. |
| Name | 5'-Hydroxyphenyl Carvedilol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 702ºC at 760 mmHg |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.47400 |
| Flash Point | 378.3ºC |
| Exact Mass | 422.18400 |
| PSA | 95.97000 |
| LogP | 3.83450 |
| Vapour Pressure | 1.1E-20mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | PVUVZUBTCLBJMT-UHFFFAOYSA-N |
| SMILES | COc1ccc(O)cc1OCCNCC(O)COc1cccc2[nH]c3ccccc3c12 |
| 3-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-4-methoxyphenol |