3-((2-Hydroxyethyl)amino)propanamide oxalate
Modify Date: 2026-07-15 20:23:15
3-((2-Hydroxyethyl)amino)propanamide oxalate structure
|
Common Name | 3-((2-Hydroxyethyl)amino)propanamide oxalate | ||
|---|---|---|---|---|
| CAS Number | 1422467-50-2 | Molecular Weight | 222.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-((2-Hydroxyethyl)amino)propanamide oxalate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H14N2O6 |
|---|---|
| Molecular Weight | 222.20 |
| InChIKey | QFWLCVQVYYRSFO-UHFFFAOYSA-N |
| SMILES | NC(=O)CCNCCO.O=C(O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1422467-50-2? |
| A: Chinese name of 1422467-50-2 is 1422467-50-2. |
| Q: What is the SMILES notation of 3-((2-Hydroxyethyl)amino)propanamide oxalate? |
| A: SMILES notation of 3-((2-Hydroxyethyl)amino)propanamide oxalate is NC(=O)CCNCCO.O=C(O)C(=O)O. |
| Q: What is the molecular weight of 3-((2-Hydroxyethyl)amino)propanamide oxalate? |
| A: Molecular weight of 3-((2-Hydroxyethyl)amino)propanamide oxalate is 222.20. |
| Q: What is the CAS number of 3-((2-Hydroxyethyl)amino)propanamide oxalate? |
| A: CAS number of 3-((2-Hydroxyethyl)amino)propanamide oxalate is 1422467-50-2. |
| Q: What is the molecular formula of 3-((2-Hydroxyethyl)amino)propanamide oxalate? |
| A: Molecular formula of 3-((2-Hydroxyethyl)amino)propanamide oxalate is C7H14N2O6. |
| Q: What is the English name of 3-((2-Hydroxyethyl)amino)propanamide oxalate? |
| A: The English name of 3-((2-Hydroxyethyl)amino)propanamide oxalate is 3-((2-Hydroxyethyl)amino)propanamide oxalate. |
| Q: What is the InChIKey of 3-((2-Hydroxyethyl)amino)propanamide oxalate? |
| A: InChIKey of 3-((2-Hydroxyethyl)amino)propanamide oxalate is QFWLCVQVYYRSFO-UHFFFAOYSA-N. |