Benzene,1,4-bis(methoxymethyl)-2,3,5,6-tetramethyl- structure
|
Common Name | Benzene,1,4-bis(methoxymethyl)-2,3,5,6-tetramethyl- | ||
|---|---|---|---|---|
| CAS Number | 1424-78-8 | Molecular Weight | 222.32300 | |
| Density | 0.954g/cm3 | Boiling Point | 295.7ºC at 760mmHg | |
| Molecular Formula | C14H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.4ºC | |
| Name | 1,4-bis(methoxymethyl)-2,3,5,6-tetramethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.954g/cm3 |
|---|---|
| Boiling Point | 295.7ºC at 760mmHg |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.32300 |
| Flash Point | 101.4ºC |
| Exact Mass | 222.16200 |
| PSA | 18.46000 |
| LogP | 3.21300 |
| Vapour Pressure | 0.00265mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | NMPFIRUDZAAOCU-UHFFFAOYSA-N |
| SMILES | COCc1c(C)c(C)c(COC)c(C)c1C |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,4-Dimethoxymethyl-2,3,5,6-tetramethylbenzen |
| 3,6-DI(METHOXYMETHYL)DURENE |
| 1,4-Bis-(methoxymethyl)-2,3,5,6-tetramethylbenzol |
| 3,6-Bis-(Methoxymethyl)-Durene |