2-butyl-3-(dimethylamino)-2-ethyl-4,4-dimethylcyclobutan-1-ol structure
|
Common Name | 2-butyl-3-(dimethylamino)-2-ethyl-4,4-dimethylcyclobutan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 14241-13-5 | Molecular Weight | 227.38600 | |
| Density | 0.92g/cm3 | Boiling Point | 289ºC at 760mmHg | |
| Molecular Formula | C14H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95ºC | |
| Name | 2-butyl-3-(dimethylamino)-2-ethyl-4,4-dimethylcyclobutan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.92g/cm3 |
|---|---|
| Boiling Point | 289ºC at 760mmHg |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.38600 |
| Flash Point | 95ºC |
| Exact Mass | 227.22500 |
| PSA | 23.47000 |
| LogP | 2.90390 |
| Vapour Pressure | 0.00025mmHg at 25°C |
| Index of Refraction | 1.48 |
| InChIKey | VEQUOQRRYHGBHZ-UHFFFAOYSA-N |
| SMILES | CCCCC1(CC)C(O)C(C)(C)C1N(C)C |
|
~%
2-butyl-3-(dime... CAS#:14241-13-5 |
| Literature: Journal of Organic Chemistry, , vol. 28, p. 1468 - 1474 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Dimethylamino-4,4-dimethyl-2-aethyl-2-butyl-cyclobutanol |
| RP 1918 |