2,2-dimethyl-7-[3-(3-phenylpropyl)thiophen-2-yl]heptanoic acid structure
|
Common Name | 2,2-dimethyl-7-[3-(3-phenylpropyl)thiophen-2-yl]heptanoic acid | ||
|---|---|---|---|---|
| CAS Number | 142422-79-5 | Molecular Weight | 358.53700 | |
| Density | 1.08g/cm3 | Boiling Point | 497.9ºC at 760 mmHg | |
| Molecular Formula | C22H30O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.9ºC | |
| Name | 2,2-dimethyl-7-[3-(3-phenylpropyl)thiophen-2-yl]heptanoic acid |
|---|
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 497.9ºC at 760 mmHg |
| Molecular Formula | C22H30O2S |
| Molecular Weight | 358.53700 |
| Flash Point | 254.9ºC |
| Exact Mass | 358.19700 |
| PSA | 65.54000 |
| LogP | 6.13710 |
| Vapour Pressure | 9.86E-11mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | QMXLXSYXJOJQSN-UHFFFAOYSA-N |
| SMILES | CC(C)(CCCCCc1sccc1CCCc1ccccc1)C(=O)O |
|
~%
2,2-dimethyl-7-... CAS#:142422-79-5 |
| Literature: Labaudiniere, Richard; Hilboll, Gerd; Leon-Lomeli, Alicia; Terlain, Bernard; Cavy, Francoise; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 17 p. 3170 - 3179 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |