methyl 1-(2-ethoxy-2-oxoethyl)pyrrolidine-3-carboxylate structure
|
Common Name | methyl 1-(2-ethoxy-2-oxoethyl)pyrrolidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 142483-57-6 | Molecular Weight | 215.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-(2-ethoxy-2-oxoethyl)pyrrolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H17NO4 |
|---|---|
| Molecular Weight | 215.24600 |
| Exact Mass | 215.11600 |
| PSA | 55.84000 |
| InChIKey | YEWLMKULNKTPIM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1CCC(C(=O)OC)C1 |
| HS Code | 2933990090 |
|---|
|
~%
methyl 1-(2-eth... CAS#:142483-57-6 |
| Literature: Jenkins; Wadsworth; Bromidge; Orlek; Wyman; Riley; Hawkins Journal of Medicinal Chemistry, 1992 , vol. 35, # 13 p. 2392 - 2406 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-<(ethoxycarbonyl)methyl>-3-(methoxycarbonyl)pyrrolidine |
| 3-(methoxycarbonyl)-1-pyrrolidineacetic acid ethyl ester |