methyl 2-(4-methoxy-1-phenyl-indazol-5-yl)acetate structure
|
Common Name | methyl 2-(4-methoxy-1-phenyl-indazol-5-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 142504-01-6 | Molecular Weight | 296.32100 | |
| Density | 1.21g/cm3 | Boiling Point | 391.5ºC at 760mmHg | |
| Molecular Formula | C17H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.5ºC | |
| Name | Methyl (4-methoxy-1-phenyl-1H-indazol-5-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 391.5ºC at 760mmHg |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.32100 |
| Flash Point | 190.5ºC |
| Exact Mass | 296.11600 |
| PSA | 53.35000 |
| LogP | 2.74960 |
| Vapour Pressure | 2.46E-06mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | ZNRVIFBCDSXYAO-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1ccc2c(cnn2-c2ccccc2)c1OC |
|
~75%
methyl 2-(4-met... CAS#:142504-01-6 |
| Literature: Farmaco, , vol. 47, # 3 p. 357 - 365 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| methyl ester of 3-oxo-indan-5-acetic acid |
| 1H-Indene-5-acetic acid,2,3-dihydro-3-oxo-,methyl ester |
| methyl ester of 4-methoxy-1-phenyl-1H-indazole-5-acetic acid |