(1s,2r)-2-(isopropylamino)-1,2-diphenylethanol structure
|
Common Name | (1s,2r)-2-(isopropylamino)-1,2-diphenylethanol | ||
|---|---|---|---|---|
| CAS Number | 142508-07-4 | Molecular Weight | 255.35500 | |
| Density | 1.061g/cm3 | Boiling Point | 378.1ºC at 760 mmHg | |
| Molecular Formula | C17H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98.2ºC | |
| Name | (1s,2r)-2-(isopropylamino)-1,2-diphenylethanol |
|---|
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 378.1ºC at 760 mmHg |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.35500 |
| Flash Point | 98.2ºC |
| Exact Mass | 255.16200 |
| PSA | 32.26000 |
| LogP | 3.85020 |
| Vapour Pressure | 2.17E-06mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | ILABSMRKFLZNPK-SJORKVTESA-N |
| SMILES | CC(C)NC(c1ccccc1)C(O)c1ccccc1 |
|
~%
(1s,2r)-2-(isop... CAS#:142508-07-4 |
| Literature: Tetrahedron Asymmetry, , vol. 3, # 11 p. 1467 - 1474 |
|
~%
(1s,2r)-2-(isop... CAS#:142508-07-4 |
| Literature: Tetrahedron Asymmetry, , vol. 3, # 11 p. 1467 - 1474 |
|
~%
(1s,2r)-2-(isop... CAS#:142508-07-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 39, # 8 p. 1967 - 1971 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |