3-(4-Chlorophenyl)-4-piperidinone Hydrochloride
Modify Date: 2025-09-09 19:15:03
3-(4-Chlorophenyl)-4-piperidinone Hydrochloride structure
|
Common Name | 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1425366-64-8 | Molecular Weight | 246.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13Cl2NO |
|---|---|
| Molecular Weight | 246.13 |
| InChIKey | MAXYZBQVIJBVKR-UHFFFAOYSA-N |
| SMILES | Cl.O=C1CCNCC1c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride? |
| A: InChIKey of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride is MAXYZBQVIJBVKR-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride? |
| A: The English name of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride is 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride. |
| Q: What is the Chinese name of 1425366-64-8? |
| A: Chinese name of 1425366-64-8 is 1425366-64-8. |
| Q: What is the molecular formula of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride? |
| A: Molecular formula of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride is C11H13Cl2NO. |
| Q: What is the CAS number of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride? |
| A: CAS number of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride is 1425366-64-8. |
| Q: What is the SMILES notation of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride? |
| A: SMILES notation of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride is Cl.O=C1CCNCC1c1ccc(Cl)cc1. |
| Q: What is the molecular weight of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride? |
| A: Molecular weight of 3-(4-Chlorophenyl)-4-piperidinone Hydrochloride is 246.13. |