4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one
Modify Date: 2026-09-20 19:38:56
![4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one Structure](https://www.chemsrc.com/extcaspic/111/1425387-28-5.png)
4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one structure
|
Common Name | 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one | ||
|---|---|---|---|---|
| CAS Number | 1425387-28-5 | Molecular Weight | 277.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15N5OS |
|---|---|
| Molecular Weight | 277.35 |
| InChIKey | XWWJVQHXQWXFFE-UHFFFAOYSA-N |
| SMILES | CSc1nc(N2CCCCC2)nc2cn[nH]c(=O)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one? |
| A: InChIKey of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one is XWWJVQHXQWXFFE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one? |
| A: Molecular formula of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one is C12H15N5OS. |
| Q: What is the SMILES notation of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one? |
| A: SMILES notation of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one is CSc1nc(N2CCCCC2)nc2cn[nH]c(=O)c12. |
| Q: What is the molecular weight of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one? |
| A: Molecular weight of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one is 277.35. |
| Q: What is the Chinese name of 1425387-28-5? |
| A: Chinese name of 1425387-28-5 is 1425387-28-5. |
| Q: What is the English name of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one? |
| A: The English name of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one is 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one. |
| Q: What is the CAS number of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one? |
| A: CAS number of 4-(Methylthio)-2-(1-piperidinyl)pyrimido[4,5-d]pyridazin-5(6H)-one is 1425387-28-5. |