1,2,3-triethyl (E)-3-fluoroprop-1-ene-1,2,3-tricarboxylate structure
|
Common Name | 1,2,3-triethyl (E)-3-fluoroprop-1-ene-1,2,3-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1426-97-7 | Molecular Weight | 276.25800 | |
| Density | 1.169g/cm3 | Boiling Point | 340.9ºC at 760 mmHg | |
| Molecular Formula | C12H17FO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.7ºC | |
| Name | triethyl (E)-3-fluoroprop-1-ene-1,2,3-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 340.9ºC at 760 mmHg |
| Molecular Formula | C12H17FO6 |
| Molecular Weight | 276.25800 |
| Flash Point | 154.7ºC |
| Exact Mass | 276.10100 |
| PSA | 78.90000 |
| LogP | 0.94020 |
| Vapour Pressure | 8.34E-05mmHg at 25°C |
| Index of Refraction | 1.445 |
| InChIKey | BZFPRFSSCMZETR-FPLPWBNLSA-N |
| SMILES | CCOC(=O)C=C(C(=O)OCC)C(F)C(=O)OCC |
|
~%
1,2,3-triethyl ... CAS#:1426-97-7 |
| Literature: Bergmann,E.D. et al. Journal of the Chemical Society [Section] C: Organic, 1967 , p. 2206 - 2207 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Fluor-propen-(1)-tricarbonsaeure-(1.2.3)-triaethylester |