2-Bromo-4-(pentafluoro-λ6-sulfanyl)phenol structure
|
Common Name | 2-Bromo-4-(pentafluoro-λ6-sulfanyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 1426290-12-1 | Molecular Weight | 299.05600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4BrF5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Bromo-4-(pentafluoro-λ6-sulfanyl)phenol |
|---|
| Molecular Formula | C6H4BrF5OS |
|---|---|
| Molecular Weight | 299.05600 |
| Exact Mass | 297.90900 |
| PSA | 45.53000 |
| LogP | 4.81210 |
| InChIKey | YPWCCOJAIASGTG-UHFFFAOYSA-N |
| SMILES | Oc1ccc(S(F)(F)(F)(F)F)cc1Br |
| HS Code | 2908199090 |
|---|
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |