((2,6-bis(1-methylethyl)phenoxy)sulfonyl)carbamic acid 2,6-bis(1-methylethyl)phenyl ester structure
|
Common Name | ((2,6-bis(1-methylethyl)phenoxy)sulfonyl)carbamic acid 2,6-bis(1-methylethyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 142642-31-7 | Molecular Weight | 461.61400 | |
| Density | 1.128g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H35NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2,6-di(propan-2-yl)phenyl] N-[2,6-di(propan-2-yl)phenoxy]sulfonylcarbamate |
|---|
| Density | 1.128g/cm3 |
|---|---|
| Molecular Formula | C25H35NO5S |
| Molecular Weight | 461.61400 |
| Exact Mass | 461.22400 |
| PSA | 90.08000 |
| LogP | 8.06410 |
| Index of Refraction | 1.536 |
| InChIKey | MHCQGCLTFBMETG-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)NS(=O)(=O)Oc1c(C(C)C)cccc1C(C)C |
|
~72%
((2,6-bis(1-met... CAS#:142642-31-7 |
| Literature: Picard, Joseph A.; O'Brien, Patrick M.; Sliskovic, Drago R.; Anderson, Maureen K.; Bousley, Richard F.; Hamelehle, Katherine L.; Krause, Brian R.; Stanfield, Richard L. Journal of Medicinal Chemistry, 1996 , vol. 39, # 6 p. 1243 - 1252 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |