7-[[6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl]oxy]-3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-benzopyran-4-one structure
|
Common Name | 7-[[6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl]oxy]-3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-benzopyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 14265-53-3 | Molecular Weight | 624.54400 | |
| Density | 1.74g/cm3 | Boiling Point | 944.5ºC at 760mmHg | |
| Molecular Formula | C28H32O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.1ºC | |
| Name | 3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 944.5ºC at 760mmHg |
| Molecular Formula | C28H32O16 |
| Molecular Weight | 624.54400 |
| Flash Point | 310.1ºC |
| Exact Mass | 624.16900 |
| PSA | 258.43000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.728 |
| InChIKey | FMZXFFXOKZSIMV-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(OC4OC(COC5OC(C)C(O)C(O)C5O)C(O)C(O)C4O)cc(O)c3c(=O)c2O)cc1O |
|
~18%
7-[[6-O-(6-deox... CAS#:14265-53-3 |
| Literature: Lewin, Guy; MacIuk, Alexandre; Moncomble, Aurelien; Cornard, Jean-Paul Journal of Natural Products, 2013 , vol. 76, # 1 p. 8 - 12 |
|
~%
7-[[6-O-(6-deox... CAS#:14265-53-3 |
| Literature: Lewin, Guy; MacIuk, Alexandre; Thoret, Sylviane; Aubert, Genevieve; Dubois, Joelle; Cresteil, Thierry Journal of Natural Products, 2010 , vol. 73, # 4 p. 702 - 706 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,3-dibenzyloxyterephthalic acid |
| 7-Rutinosyl-3',5,7-trihydroxy-4'-methoxy-flavonol |
| tamarixetin 7-rutinoside |
| Rutinosyl-7-trihydroxy-3',5,7-methoxy-4'-flavonol |
| thulium fluoride |
| Tamarixetin-7-O-rutinoside |
| tamarium trifluoride |
| thullium fluoride |