1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid structure
|
Common Name | 1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 14271-45-5 | Molecular Weight | 205.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11NO3 |
|---|---|
| Molecular Weight | 205.21000 |
| Exact Mass | 205.07400 |
| PSA | 57.61000 |
| LogP | 1.28630 |
| InChIKey | BCKRBJBCJOYSLP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(C(=O)O)c2ccccc21 |
| HS Code | 2933790090 |
|---|
|
~%
1-methyl-2-oxo-... CAS#:14271-45-5 |
| Literature: Aeschlimann Journal of the Chemical Society, 1926 , p. 2908 |
|
~%
1-methyl-2-oxo-... CAS#:14271-45-5 |
| Literature: Aeschlimann Journal of the Chemical Society, 1926 , p. 2908 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| 1-methyl-2-oxo-1,3,4-trihydroquinoline-4-carboxylic acid |
| 1-Methyl-2-oxo-1,2,3,4-tetrahydro-chinolin-4-carbonsaeure |
| 1-methyl-2-oxo-1,2,3,4-tetrahydro-quinoline-4-carboxylic acid |