Coumarin, 3-formyl-4-methyl-7-(N,N-diethyl amino)- structure
|
Common Name | Coumarin, 3-formyl-4-methyl-7-(N,N-diethyl amino)- | ||
|---|---|---|---|---|
| CAS Number | 142730-48-1 | Molecular Weight | 259.30000 | |
| Density | 1.23g/cm3 | Boiling Point | 456.6ºC at 760mmHg | |
| Molecular Formula | C15H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.9ºC | |
| Name | 7-(diethylamino)-4-methyl-2-oxochromene-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 456.6ºC at 760mmHg |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30000 |
| Flash Point | 229.9ºC |
| Exact Mass | 259.12100 |
| PSA | 50.52000 |
| LogP | 2.76010 |
| Vapour Pressure | 1.6E-08mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | ICAXYTLHINMBNG-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2c(C)c(C=O)c(=O)oc2c1 |
|
~72%
Coumarin, 3-for... CAS#:142730-48-1 |
| Literature: Kirpichenok, M.A.; Baukulev, V.M.; Karandashova, L.A.; Grandberg, I.I. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1991 , vol. 27, # 11 p. 1193 - 1199 Khimiya Geterotsiklicheskikh Soedinenii, 1991 , # 11 p. 1480 - 1487 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-formyl-4-methyl-7-diethylamino-2-H-benzopyran-2-one |