JWH 200 4-hydroxyindole metabolite structure
|
Common Name | JWH 200 4-hydroxyindole metabolite | ||
|---|---|---|---|---|
| CAS Number | 1427325-73-2 | Molecular Weight | 400.470 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 648.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.9±31.5 °C | |
Use of JWH 200 4-hydroxyindole metaboliteJWH 200 4-hydroxyindole metabolite is expected to be a urinary metabolite of JWH 200 based on the metabolism of the closely-related JWH 015 and JWH 018. |
| Name | {4-Hydroxy-1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl}(1-naphthyl)m ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 648.3±55.0 °C at 760 mmHg |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.470 |
| Flash Point | 345.9±31.5 °C |
| Exact Mass | 400.178680 |
| PSA | 54.70000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | BZFDQRQHYLPNHW-UHFFFAOYSA-N |
| SMILES | O=C(c1cccc2ccccc12)c1cn(CCN2CCOCC2)c2cccc(O)c12 |
| {4-Hydroxy-1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl}(1-naphthyl)methanone |
| Methanone, [4-hydroxy-1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]-1-naphthalenyl- |