JWH 250 N-(4-hydroxypentyl) metabolite structure
|
Common Name | JWH 250 N-(4-hydroxypentyl) metabolite | ||
|---|---|---|---|---|
| CAS Number | 1427521-38-7 | Molecular Weight | 351.439 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 541.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C22H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.4±27.3 °C | |
Use of JWH 250 N-(4-hydroxypentyl) metaboliteJWH 250 N-(4-hydroxypentyl) metabolite is expected to be a cytochrome P450 phase I metabolite of JWH 250, detectable both in serum and urine. |
| Name | JWH 250 N-(4-hydroxypentyl) metabolite |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.7±40.0 °C at 760 mmHg |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.439 |
| Flash Point | 281.4±27.3 °C |
| Exact Mass | 351.183441 |
| PSA | 51.46000 |
| LogP | 3.18 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | GMXLLEJMDHWZNM-UHFFFAOYSA-N |
| SMILES | COc1ccccc1CC(=O)c1cn(CCCC(C)O)c2ccccc12 |
| Ethanone, 1-[1-(4-hydroxypentyl)-1H-indol-3-yl]-2-(2-methoxyphenyl)- |
| 1-[1-(4-Hydroxypentyl)-1H-indol-3-yl]-2-(2-methoxyphenyl)ethanone |