Neopentylglycol-bis-acetoacetate structure
|
Common Name | Neopentylglycol-bis-acetoacetate | ||
|---|---|---|---|---|
| CAS Number | 14276-67-6 | Molecular Weight | 272.29400 | |
| Density | 1.114 | Boiling Point | 148ºC (0.2 Torr) | |
| Molecular Formula | C13H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164ºC | |
| Name | 2,2-Dimethylpropane-1,3-diyl bis(3-oxobutanoate) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114 |
|---|---|
| Boiling Point | 148ºC (0.2 Torr) |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.29400 |
| Flash Point | 164ºC |
| Exact Mass | 272.12600 |
| PSA | 86.74000 |
| LogP | 1.05720 |
| InChIKey | RASITSWSKYLIEX-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)OCC(C)(C)COC(=O)CC(C)=O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| [2,2-dimethyl-3-(3-oxobutanoyloxy)propyl] 3-oxobutanoate |