ent-Oseltamivir Phosphate
Modify Date: 2025-11-02 10:00:56
ent-Oseltamivir Phosphate structure
|
Common Name | ent-Oseltamivir Phosphate | ||
|---|---|---|---|---|
| CAS Number | 1428126-71-9 | Molecular Weight | 410.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H31N2O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ent-Oseltamivir Phosphate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H31N2O8P |
|---|---|
| Molecular Weight | 410.40 |
| InChIKey | PGZUMBJQJWIWGJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(OC(CC)CC)C(NC(C)=O)C(N)C1.O=P(O)(O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ent-Oseltamivir Phosphate? |
| A: CAS number of ent-Oseltamivir Phosphate is 1428126-71-9. |
| Q: What is the molecular formula of ent-Oseltamivir Phosphate? |
| A: Molecular formula of ent-Oseltamivir Phosphate is C16H31N2O8P. |
| Q: What is the English name of ent-Oseltamivir Phosphate? |
| A: The English name of ent-Oseltamivir Phosphate is ent-Oseltamivir Phosphate. |
| Q: What is the SMILES notation of ent-Oseltamivir Phosphate? |
| A: SMILES notation of ent-Oseltamivir Phosphate is CCOC(=O)C1=CC(OC(CC)CC)C(NC(C)=O)C(N)C1.O=P(O)(O)O. |
| Q: What is the molecular weight of ent-Oseltamivir Phosphate? |
| A: Molecular weight of ent-Oseltamivir Phosphate is 410.40. |
| Q: What is the Chinese name of 1428126-71-9? |
| A: Chinese name of 1428126-71-9 is 1428126-71-9. |
| Q: What is the InChIKey of ent-Oseltamivir Phosphate? |
| A: InChIKey of ent-Oseltamivir Phosphate is PGZUMBJQJWIWGJ-UHFFFAOYSA-N. |