5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione
Modify Date: 2025-09-09 12:43:31
![5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione Structure](https://www.chemsrc.com/extcaspic/446/1428147-22-1.png)
5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione structure
|
Common Name | 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 1428147-22-1 | Molecular Weight | 297.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10F3N3O2 |
|---|---|
| Molecular Weight | 297.23 |
| InChIKey | FYHJTAMJTKXYFP-UHFFFAOYSA-N |
| SMILES | O=C1C2NN=C(C(F)(F)F)C2C(=O)N1Cc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione? |
| A: InChIKey of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione is FYHJTAMJTKXYFP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione? |
| A: SMILES notation of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione is O=C1C2NN=C(C(F)(F)F)C2C(=O)N1Cc1ccccc1. |
| Q: What is the English name of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione? |
| A: The English name of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione is 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione. |
| Q: What is the molecular formula of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione? |
| A: Molecular formula of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione is C13H10F3N3O2. |
| Q: What is the Chinese name of 1428147-22-1? |
| A: Chinese name of 1428147-22-1 is 1428147-22-1. |
| Q: What is the molecular weight of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione? |
| A: Molecular weight of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione is 297.23. |
| Q: What is the CAS number of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione? |
| A: CAS number of 5-benzyl-3-(trifluoromethyl)-1H,3aH,6aH-pyrrolo[3,4-c]pyrazole-4,6-dione is 1428147-22-1. |