2,5-Thiophenedicarboxylicacid, 3,4-dihydroxy- structure
|
Common Name | 2,5-Thiophenedicarboxylicacid, 3,4-dihydroxy- | ||
|---|---|---|---|---|
| CAS Number | 14282-58-7 | Molecular Weight | 204.15700 | |
| Density | 2.295g/cm3 | Boiling Point | 315.6ºC at 760mmHg | |
| Molecular Formula | C6H4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.7ºC | |
| Name | 3,4-dihydroxythiophene-2,5-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.295g/cm3 |
|---|---|
| Boiling Point | 315.6ºC at 760mmHg |
| Molecular Formula | C6H4O6S |
| Molecular Weight | 204.15700 |
| Flash Point | 144.7ºC |
| Exact Mass | 203.97300 |
| PSA | 143.30000 |
| LogP | 0.55570 |
| Vapour Pressure | 3.67E-05mmHg at 25°C |
| Index of Refraction | 1.901 |
| InChIKey | YJQSEUFVWQCHCP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1sc(C(=O)O)c(O)c1O |
|
~%
2,5-Thiophenedi... CAS#:14282-58-7 |
| Literature: Du Pont de Nemours and Co. Patent: US2453102 , 1944 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,5-bis(dihydroxymethylidene)thiolane-3,4-dione |
| 3,4-dihydroxy-thiophene-2,5-dicarboxylic acid |
| 2,5-Thiophenedicarboxylicacid,3,4-dihydroxy |
| 3,4-Dihydroxy-thiophen-dicarbonsaeure-(2,5) |
| 3,4-Dihydroxy-thiophen-2,5-dicarbonsaeure |