phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate
Modify Date: 2026-07-03 21:38:58
phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate structure
|
Common Name | phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1428362-82-6 | Molecular Weight | 406.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H26N4O4S |
|---|---|
| Molecular Weight | 406.5 |
| InChIKey | ZXESFROYUJFZTO-UHFFFAOYSA-N |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)NCC1CCN(C(=O)Oc2ccccc2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate? |
| A: The English name of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate is phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate. |
| Q: What is the Chinese name of 1428362-82-6? |
| A: Chinese name of 1428362-82-6 is 1428362-82-6. |
| Q: What is the molecular weight of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate? |
| A: Molecular weight of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate is 406.5. |
| Q: What is the CAS number of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate? |
| A: CAS number of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate is 1428362-82-6. |
| Q: What is the SMILES notation of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate? |
| A: SMILES notation of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate is Cc1nn(C)c(C)c1S(=O)(=O)NCC1CCN(C(=O)Oc2ccccc2)CC1. |
| Q: What is the InChIKey of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate? |
| A: InChIKey of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate is ZXESFROYUJFZTO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate? |
| A: Molecular formula of phenyl 4-((1,3,5-trimethyl-1H-pyrazole-4-sulfonamido)methyl)piperidine-1-carboxylate is C19H26N4O4S. |