4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide
Modify Date: 2025-10-21 16:24:04
![4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide Structure](https://www.chemsrc.com/extcaspic/009/1428362-91-7.png)
4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide structure
|
Common Name | 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide | ||
|---|---|---|---|---|
| CAS Number | 1428362-91-7 | Molecular Weight | 357.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H27N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H27N3OS |
|---|---|
| Molecular Weight | 357.5 |
| InChIKey | FAROOKYAFGKMSQ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)NCCN2CCC(c3cccs3)CC2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide? |
| A: Molecular formula of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide is C20H27N3OS. |
| Q: What is the CAS number of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide? |
| A: CAS number of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide is 1428362-91-7. |
| Q: What is the English name of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide? |
| A: The English name of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide is 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide. |
| Q: What is the InChIKey of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide? |
| A: InChIKey of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide is FAROOKYAFGKMSQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide? |
| A: SMILES notation of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide is CN(C)c1ccc(C(=O)NCCN2CCC(c3cccs3)CC2)cc1. |
| Q: What is the molecular weight of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide? |
| A: Molecular weight of 4-(Dimethylamino)-N-{2-[4-(thiophen-2-YL)piperidin-1-YL]ethyl}benzamide is 357.5. |
| Q: What is the Chinese name of 1428362-91-7? |
| A: Chinese name of 1428362-91-7 is 1428362-91-7. |