Ac-Phe-Lys-OH structure
|
Common Name | Ac-Phe-Lys-OH | ||
|---|---|---|---|---|
| CAS Number | 14287-21-9 | Molecular Weight | 335.40 | |
| Density | 1.19g/cm3 | Boiling Point | 681.2ºC at 760mmHg | |
| Molecular Formula | C17H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.8ºC | |
Use of Ac-Phe-Lys-OHAc-Phe-Lys-OH is a inverted Aspartame type sweetener[1]. |
| Name | Ac-Phe-Lys-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Ac-Phe-Lys-OH is a inverted Aspartame type sweetener[1]. |
|---|---|
| Related Catalog |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 681.2ºC at 760mmHg |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 |
| Flash Point | 365.8ºC |
| Exact Mass | 335.18500 |
| PSA | 121.52000 |
| LogP | 1.91430 |
| Vapour Pressure | 1.72E-19mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | AVXRNUMVGRLMBL-GJZGRUSLSA-N |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)O |
| Storage condition | -15°C |
| N-acetyl-phenylalanine-lysine |
| N-acetyl-phe-lys |