Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester
Modify Date: 2025-08-24 16:55:54
![Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester Structure](https://www.chemsrc.com/extcaspic/410/1428944-41-5.png)
Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester structure
|
Common Name | Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester | ||
|---|---|---|---|---|
| CAS Number | 1428944-41-5 | Molecular Weight | 644.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H68O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H68O9 |
|---|---|
| Molecular Weight | 644.9 |
| InChIKey | DTNVAVRAOYVBOT-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OCCOCC(CC)(COCCOC(=O)C(CC)CCCC)COCCOC(=O)C(CC)CCCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester? |
| A: CAS number of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester is 1428944-41-5. |
| Q: What is the molecular weight of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester? |
| A: Molecular weight of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester is 644.9. |
| Q: What is the SMILES notation of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester? |
| A: SMILES notation of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester is CCCCC(CC)C(=O)OCCOCC(CC)(COCCOC(=O)C(CC)CCCC)COCCOC(=O)C(CC)CCCC. |
| Q: What is the English name of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester? |
| A: The English name of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester is Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester. |
| Q: What is the InChIKey of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester? |
| A: InChIKey of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester is DTNVAVRAOYVBOT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1428944-41-5? |
| A: Chinese name of 1428944-41-5 is 1428944-41-5. |
| Q: What is the molecular formula of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester? |
| A: Molecular formula of Hexanoic acid, 2-ethyl-, 1,1'-[2-ethyl-2-[[2-[(2-ethyl-1-oxohexyl)oxy]ethoxy]methyl]-1,3-propanediyl] ester is C36H68O9. |