3ʼ,5-dihydroxy-3,4ʼ,5ʼ,7-tetramethoxyflavone structure
|
Common Name | 3ʼ,5-dihydroxy-3,4ʼ,5ʼ,7-tetramethoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 14290-57-4 | Molecular Weight | 374.34100 | |
| Density | 1.44g/cm3 | Boiling Point | 627.5ºC at 760 mmHg | |
| Molecular Formula | C19H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.2ºC | |
| Name | 3ʼ,5-dihydroxy-3,4ʼ,5ʼ,7-tetramethoxyflavone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 627.5ºC at 760 mmHg |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.34100 |
| Flash Point | 227.2ºC |
| Exact Mass | 374.10000 |
| PSA | 107.59000 |
| LogP | 2.90560 |
| Vapour Pressure | 2.45E-16mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | LLDTYMGZAXZDDU-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3cc(O)c(OC)c(OC)c3)oc2c1 |
|
~%
3ʼ,5-dihydroxy-... CAS#:14290-57-4 |
| Literature: Chand, Lal; Maurya, R.; Ray, A. B. Journal of the Indian Chemical Society, 1982 , vol. 59, # 8 p. 1001 - 1003 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,7,3',4'-tetra-O-methylmyricetin |
| myricetin 3,4',5',7-tetramethyl ether |
| 5,3'-dihydroxy-3,7,4',5'-tetramethoxyflavone |
| myricetin 3,7,4',5'-tetramethyl ether |
| 3',5-dihydroxy-3,4',5',7-tetramethoxyflavone |
| Myricetin 3,7,3',4'-tetramethyl ether |
| 5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-3,7-dimethoxychromen-4-one |