2,5-Bisanilinoterephthalic acid diethyl ester structure
|
Common Name | 2,5-Bisanilinoterephthalic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 14297-59-7 | Molecular Weight | 404.45800 | |
| Density | 1.224g/cm3 | Boiling Point | 563.5ºC at 760 mmHg | |
| Molecular Formula | C24H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.6ºC | |
| Name | diethyl 2,5-dianilinobenzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 563.5ºC at 760 mmHg |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.45800 |
| Flash Point | 294.6ºC |
| Exact Mass | 404.17400 |
| PSA | 76.66000 |
| LogP | 5.67320 |
| Vapour Pressure | 1.01E-12mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | FVXKBIAYJSJUBJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Nc2ccccc2)c(C(=O)OCC)cc1Nc1ccccc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2,5-dianilino-terephthalic acid diethyl ester |
| ethyl 2,5-dianilinoterephthalate |
| 2,5-Dianilino-terephthalsaeure-diaethylester |
| 2,5-Dianilino-terephthalsaeure-diethylester |
| diethyl 2,5-dianilinoterephthalate |
| diethyl NN'-diphenyl-2,5-diaminoterephthalate |