4-[[4-[(4-cyanophenyl)methylsulfanylmethyl]-2,5-dioxoimidazolidin-4-yl]methylsulfanylmethyl]benzonitrile structure
|
Common Name | 4-[[4-[(4-cyanophenyl)methylsulfanylmethyl]-2,5-dioxoimidazolidin-4-yl]methylsulfanylmethyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 142979-83-7 | Molecular Weight | 422.52300 | |
| Density | 1.39g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H18N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[4-[(4-cyanophenyl)methylsulfanylmethyl]-2,5-dioxoimidazolidin-4-yl]methylsulfanylmethyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Molecular Formula | C21H18N4O2S2 |
| Molecular Weight | 422.52300 |
| Exact Mass | 422.08700 |
| PSA | 163.36000 |
| LogP | 3.09066 |
| Index of Refraction | 1.683 |
| InChIKey | XHNNGPYOUAGHSY-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(CSCC2(CSCc3ccc(C#N)cc3)NC(=O)NC2=O)cc1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: Inhibition of HIV-1 RF viral production in MT-2 cells.
Source: ChEMBL
Target: Human immunodeficiency virus type 1 (RF/HAT ISOLATE)
External Id: CHEMBL712240
|
|
Name: Inhibition of HIV-1 RF induced cytotoxicity in MT-2 cells; Inactive.
Source: ChEMBL
Target: MT2
External Id: CHEMBL711406
|
| 5,5di-4CNBzSMe hydantoin |