4-phenyl-1-trimethylsilylbutan-1-one structure
|
Common Name | 4-phenyl-1-trimethylsilylbutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 142981-60-0 | Molecular Weight | 220.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-phenyl-1-trimethylsilylbutan-1-one |
|---|
| Molecular Formula | C13H20OSi |
|---|---|
| Molecular Weight | 220.38300 |
| Exact Mass | 220.12800 |
| PSA | 17.07000 |
| LogP | 3.45580 |
| InChIKey | IOUSNDHLJQNKDP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(=O)CCCc1ccccc1 |
|
~81%
4-phenyl-1-trim... CAS#:142981-60-0 |
| Literature: Chemical Communications, , # 23 p. 2466 - 2468 |
|
~54%
4-phenyl-1-trim... CAS#:142981-60-0 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 78, # 3 p. 477 - 486 |