4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one
4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one structure
|
Common Name | 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 142991-73-9 | Molecular Weight | 241.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14F3NO3 |
|---|---|
| Molecular Weight | 241.20800 |
| Exact Mass | 241.09300 |
| PSA | 47.56000 |
| LogP | 1.62100 |
| InChIKey | UFOWOORSVSYSHX-UHFFFAOYSA-N |
| SMILES | COC(CNC(C)=CC(=O)C(F)(F)F)OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
4-(2,2-dimethox... CAS#:142991-73-9 |
| Literature: Okada; Masuda; Hojo; Inoue Synthesis, 1992 , # 6 p. 533 - 535 Title/Abstract Full Text View citing articles Show Details Okada, Etsuji; Masuda, Ryoichi; Hojo, Masaru; Yoshida, Reiko Heterocycles, 1992 , vol. 34, # 7 p. 1435 - 1441 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:144219-83-0
CAS#:144219-84-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 142991-73-9? |
| A: Chinese name of 142991-73-9 is 142991-73-9. |
| Q: What are the downstream products of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one? |
| A: Related downstream products(CAS) of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one: 144219-83-0;144219-84-1. |
| Q: What is the English name of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one? |
| A: The English name of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one is 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one. |
| Q: What is the molecular formula of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one? |
| A: Molecular formula of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one is C9H14F3NO3. |
| Q: What is the molecular weight of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one? |
| A: Molecular weight of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one is 241.20800. |
| Q: What are the upstream materials of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one? |
| A: Related upstream materials(CAS) of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one: 135351-20-1;22483-09-6. |
| Q: What is the polar surface area (PSA) of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one? |
| A: Polar surface area (PSA) of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one is 47.56000. |
| Q: What is the LogP of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one? |
| A: LogP of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one is 1.62100. |
| Q: What is the SMILES notation of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one? |
| A: SMILES notation of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one is COC(CNC(C)=CC(=O)C(F)(F)F)OC. |
| Q: What is the CAS number of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one? |
| A: CAS number of 4-(2,2-dimethoxyethylamino)-1,1,1-trifluoropent-3-en-2-one is 142991-73-9. |