7,8-dichloro-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one structure
|
Common Name | 7,8-dichloro-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one | ||
|---|---|---|---|---|
| CAS Number | 143007-00-5 | Molecular Weight | 255.06000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7,8-dichloro-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one |
|---|
| Molecular Formula | C9H4Cl2N4O |
|---|---|
| Molecular Weight | 255.06000 |
| Exact Mass | 253.97600 |
| PSA | 63.05000 |
| LogP | 1.87760 |
| InChIKey | IESYTBDOVCIPKA-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2cc(Cl)c(Cl)cc2n2cnnc12 |
|
~%
7,8-dichloro-5H... CAS#:143007-00-5 |
| Literature: McQuaid; Smith; South; Mitch; Schoepp; True; Calligaro; O'Malley; Lodge; Ornstein Journal of Medicinal Chemistry, 1992 , vol. 35, # 18 p. 3319 - 3324 |
|
~%
7,8-dichloro-5H... CAS#:143007-00-5 |
| Literature: McQuaid; Smith; South; Mitch; Schoepp; True; Calligaro; O'Malley; Lodge; Ornstein Journal of Medicinal Chemistry, 1992 , vol. 35, # 18 p. 3319 - 3324 |
|
~%
7,8-dichloro-5H... CAS#:143007-00-5 |
| Literature: McQuaid; Smith; South; Mitch; Schoepp; True; Calligaro; O'Malley; Lodge; Ornstein Journal of Medicinal Chemistry, 1992 , vol. 35, # 18 p. 3319 - 3324 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |