Leflutrozole structure
|
Common Name | Leflutrozole | ||
|---|---|---|---|---|
| CAS Number | 143030-47-1 | Molecular Weight | 303.29300 | |
| Density | 1.24g/cm3 | Boiling Point | 565.7ºC at 760mmHg | |
| Molecular Formula | C17H10FN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.9ºC | |
Use of LeflutrozoleA potent aromatase inhibitor for the treatment of hypogonadism.. |
| Name | 4-[(4-cyanophenyl)-fluoro-(1,2,4-triazol-1-yl)methyl]benzonitrile |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 565.7ºC at 760mmHg |
| Molecular Formula | C17H10FN5 |
| Molecular Weight | 303.29300 |
| Flash Point | 295.9ºC |
| Exact Mass | 303.09200 |
| PSA | 78.29000 |
| LogP | 2.74036 |
| Vapour Pressure | 8.11E-13mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | PZDLRBUQYWMNBR-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(F)(c2ccc(C#N)cc2)n2cncn2)cc1 |