3-phosphono-2-imino-1-methyl-4-oxoimidazolidine structure
|
Common Name | 3-phosphono-2-imino-1-methyl-4-oxoimidazolidine | ||
|---|---|---|---|---|
| CAS Number | 14307-18-7 | Molecular Weight | 193.09800 | |
| Density | 2.02g/cm3 | Boiling Point | 353.5ºC at 760mmHg | |
| Molecular Formula | C4H8N3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.6ºC | |
| Name | (2-imino-3-methyl-5-oxoimidazolidin-1-yl)phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.02g/cm3 |
|---|---|
| Boiling Point | 353.5ºC at 760mmHg |
| Molecular Formula | C4H8N3O4P |
| Molecular Weight | 193.09800 |
| Flash Point | 167.6ºC |
| Exact Mass | 193.02500 |
| PSA | 114.74000 |
| Vapour Pressure | 6.01E-06mmHg at 25°C |
| Index of Refraction | 1.735 |
| InChIKey | WGFPKVYOZXLIPN-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)N(P(=O)(O)O)C1=N |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| PIMOI |
| 3-Phosphono-2-imino-1-methyl-4-oxoimidazolidine |
| phosphocreatinine |