tert-Butyl pyridin-2-ylglycinate dihydrochloride
Modify Date: 2026-08-07 15:02:34
tert-Butyl pyridin-2-ylglycinate dihydrochloride structure
|
Common Name | tert-Butyl pyridin-2-ylglycinate dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1430839-70-5 | Molecular Weight | 281.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl pyridin-2-ylglycinate dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18Cl2N2O2 |
|---|---|
| Molecular Weight | 281.18 |
| InChIKey | ZIWFDZIELSTRFD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CNc1ccccn1.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1430839-70-5? |
| A: Chinese name of 1430839-70-5 is 1430839-70-5. |
| Q: What is the English name of tert-Butyl pyridin-2-ylglycinate dihydrochloride? |
| A: The English name of tert-Butyl pyridin-2-ylglycinate dihydrochloride is tert-Butyl pyridin-2-ylglycinate dihydrochloride. |
| Q: What is the SMILES notation of tert-Butyl pyridin-2-ylglycinate dihydrochloride? |
| A: SMILES notation of tert-Butyl pyridin-2-ylglycinate dihydrochloride is CC(C)(C)OC(=O)CNc1ccccn1.Cl.Cl. |
| Q: What is the molecular weight of tert-Butyl pyridin-2-ylglycinate dihydrochloride? |
| A: Molecular weight of tert-Butyl pyridin-2-ylglycinate dihydrochloride is 281.18. |
| Q: What is the InChIKey of tert-Butyl pyridin-2-ylglycinate dihydrochloride? |
| A: InChIKey of tert-Butyl pyridin-2-ylglycinate dihydrochloride is ZIWFDZIELSTRFD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of tert-Butyl pyridin-2-ylglycinate dihydrochloride? |
| A: Molecular formula of tert-Butyl pyridin-2-ylglycinate dihydrochloride is C11H18Cl2N2O2. |
| Q: What is the CAS number of tert-Butyl pyridin-2-ylglycinate dihydrochloride? |
| A: CAS number of tert-Butyl pyridin-2-ylglycinate dihydrochloride is 1430839-70-5. |