dimethyl 4,5-dimethylcyclohexa-1,4-diene-1,2-dicarboxylate structure
|
Common Name | dimethyl 4,5-dimethylcyclohexa-1,4-diene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 14309-24-1 | Molecular Weight | 224.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 4,5-dimethylcyclohexa-1,4-diene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O4 |
|---|---|
| Molecular Weight | 224.25300 |
| Exact Mass | 224.10500 |
| PSA | 52.60000 |
| LogP | 1.75920 |
| InChIKey | CVFAUXQYWPECKA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=O)OC)CC(C)=C(C)C1 |
|
~96%
dimethyl 4,5-di... CAS#:14309-24-1 |
| Literature: Journal of Fluorine Chemistry, , vol. 130, # 7 p. 629 - 639 |
|
~%
dimethyl 4,5-di... CAS#:14309-24-1 |
| Literature: Journal of Organometallic Chemistry, , vol. 601, # 1 p. 147 - 152 |
|
~%
dimethyl 4,5-di... CAS#:14309-24-1 |
| Literature: Chemische Berichte, , vol. 113, # 2 p. 531 - 541 |
| 4,5-dimethyl-cyclohexa-1,4-diene-1,2-dicarboxylic acid dimethyl ester |
| Dimethyl 3,6-dihydro-4,5-dimethyl phthalate |
| 11P-115 |
| 1,4-Cyclohexadiene-1,2-dicarboxylic acid,4,5-dimethyl-,dimethyl ester |
| 4,5-Dimethyl-1,4-cyclohexadien-1,4-dicarbonsaeuremethylester |
| 4,5-Dimethyl-1,4-cyclohexadien-1,2-dicarbonsaeure-dimethylester |
| Dimethyl 4,5-dimethyl-1,4-cyclohexadiene-1,2-dicarboxylate |
| 4,5-Dimethyl-cyclohexa-1,4-dien-1,2-dicarbonsaeure-dimethylester |